C20H28ClN3O2 — CID 42716945
N-[1-(7-chloro-3-methyl-4-oxoquinazolin-2-yl)ethyl]-N-pentylbutanamide (PubChem CID 42716945) has the molecular formula C20H28ClN3O2 and a molecular weight of 377.92 g/mol. Its IUPAC name is N-[1-(7-chloro-3-methyl-4-oxoquinazolin-2-yl)ethyl]-N-pentylbutanamide.
| Compound Name | N-[1-(7-chloro-3-methyl-4-oxoquinazolin-2-yl)ethyl]-N-pentylbutanamide |
|---|---|
| PubChem CID | 42716945 |
| Molecular Formula | C20H28ClN3O2 |
| Molecular Weight | 377.92 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | N-[1-(7-chloro-3-methyl-4-oxoquinazolin-2-yl)ethyl]-N-pentylbutanamide |
| SMILES | CCCCCN(C(=O)CCC)C(C)c1nc2cc(Cl)ccc2c(=O)n1C |
| InChI | InChI=1S/C20H28ClN3O2/c1-5-7-8-12-24(18(25)9-6-2)14(3)19-22-17-13-15(21)10-11-16(17)20(26)23(19)4/h10-11,13-14H,5-9,12H2,1-4H3 |
| InChIKey | XHABNNYODNRAMD-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.92 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|