C22H33ClN4O2 — CID 42714938
N-[1-(7-chloro-3-methyl-4-oxoquinazolin-2-yl)ethyl]-N-[2-(dimethylamino)ethyl]heptanamide (PubChem CID 42714938) has the molecular formula C22H33ClN4O2 and a molecular weight of 420.99 g/mol. Its IUPAC name is N-[1-(7-chloro-3-methyl-4-oxoquinazolin-2-yl)ethyl]-N-[2-(dimethylamino)ethyl]heptanamide.
| Compound Name | N-[1-(7-chloro-3-methyl-4-oxoquinazolin-2-yl)ethyl]-N-[2-(dimethylamino)ethyl]heptanamide |
|---|---|
| PubChem CID | 42714938 |
| Molecular Formula | C22H33ClN4O2 |
| Molecular Weight | 420.99 g/mol |
| Exact Mass | 420.23 |
| IUPAC Name | N-[1-(7-chloro-3-methyl-4-oxoquinazolin-2-yl)ethyl]-N-[2-(dimethylamino)ethyl]heptanamide |
| SMILES | CCCCCCC(=O)N(CCN(C)C)C(C)c1nc2cc(Cl)ccc2c(=O)n1C |
| InChI | InChI=1S/C22H33ClN4O2/c1-6-7-8-9-10-20(28)27(14-13-25(3)4)16(2)21-24-19-15-17(23)11-12-18(19)22(29)26(21)5/h11-12,15-16H,6-10,13-14H2,1-5H3 |
| InChIKey | VGKPOOSIRZWCCM-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.99 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|