C24H28BrClN4O2 — CID 5115824
N-(6-aminohexyl)-2-bromo-N-[1-(7-chloro-3-methyl-4-oxoquinazolin-2-yl)ethyl]benzamide (PubChem CID 5115824) has the molecular formula C24H28BrClN4O2 and a molecular weight of 519.87 g/mol. Its IUPAC name is N-(6-aminohexyl)-2-bromo-N-[1-(7-chloro-3-methyl-4-oxoquinazolin-2-yl)ethyl]benzamide.
| Compound Name | N-(6-aminohexyl)-2-bromo-N-[1-(7-chloro-3-methyl-4-oxoquinazolin-2-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 5115824 |
| Molecular Formula | C24H28BrClN4O2 |
| Molecular Weight | 519.87 g/mol |
| Exact Mass | 518.11 |
| IUPAC Name | N-(6-aminohexyl)-2-bromo-N-[1-(7-chloro-3-methyl-4-oxoquinazolin-2-yl)ethyl]benzamide |
| SMILES | CC(c1nc2cc(Cl)ccc2c(=O)n1C)N(CCCCCCN)C(=O)c1ccccc1Br |
| InChI | InChI=1S/C24H28BrClN4O2/c1-16(22-28-21-15-17(26)11-12-19(21)23(31)29(22)2)30(14-8-4-3-7-13-27)24(32)18-9-5-6-10-20(18)25/h5-6,9-12,15-16H,3-4,7-8,13-14,27H2,1-2H3 |
| InChIKey | UOKDILIGIIVSNA-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 81.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.87 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|