C27H33F3N4O3 — CID 3401814
N-(6-aminohexyl)-N-[1-[3-(2-methoxyethyl)-4-oxoquinazolin-2-yl]ethyl]-3-(trifluoromethyl)benzamide (PubChem CID 3401814) has the molecular formula C27H33F3N4O3 and a molecular weight of 518.58 g/mol. Its IUPAC name is N-(6-aminohexyl)-N-[1-[3-(2-methoxyethyl)-4-oxoquinazolin-2-yl]ethyl]-3-(trifluoromethyl)benzamide.
| Compound Name | N-(6-aminohexyl)-N-[1-[3-(2-methoxyethyl)-4-oxoquinazolin-2-yl]ethyl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 3401814 |
| Molecular Formula | C27H33F3N4O3 |
| Molecular Weight | 518.58 g/mol |
| Exact Mass | 518.25 |
| IUPAC Name | N-(6-aminohexyl)-N-[1-[3-(2-methoxyethyl)-4-oxoquinazolin-2-yl]ethyl]-3-(trifluoromethyl)benzamide |
| SMILES | COCCn1c(C(C)N(CCCCCCN)C(=O)c2cccc(C(F)(F)F)c2)nc2ccccc2c1=O |
| InChI | InChI=1S/C27H33F3N4O3/c1-19(24-32-23-13-6-5-12-22(23)26(36)34(24)16-17-37-2)33(15-8-4-3-7-14-31)25(35)20-10-9-11-21(18-20)27(28,29)30/h5-6,9-13,18-19H,3-4,7-8,14-17,31H2,1-2H3 |
| InChIKey | ZWHSPCGGPQKUMX-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 90.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.58 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|