C28H31N3O4 — CID 42728594
N-[1-[3-(2-methoxyethyl)-4-oxoquinazolin-2-yl]ethyl]-N-(3-methoxypropyl)naphthalene-2-carboxamide (PubChem CID 42728594) has the molecular formula C28H31N3O4 and a molecular weight of 473.57 g/mol. Its IUPAC name is N-[1-[3-(2-methoxyethyl)-4-oxoquinazolin-2-yl]ethyl]-N-(3-methoxypropyl)naphthalene-2-carboxamide.
| Compound Name | N-[1-[3-(2-methoxyethyl)-4-oxoquinazolin-2-yl]ethyl]-N-(3-methoxypropyl)naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 42728594 |
| Molecular Formula | C28H31N3O4 |
| Molecular Weight | 473.57 g/mol |
| Exact Mass | 473.23 |
| IUPAC Name | N-[1-[3-(2-methoxyethyl)-4-oxoquinazolin-2-yl]ethyl]-N-(3-methoxypropyl)naphthalene-2-carboxamide |
| SMILES | COCCCN(C(=O)c1ccc2ccccc2c1)C(C)c1nc2ccccc2c(=O)n1CCOC |
| InChI | InChI=1S/C28H31N3O4/c1-20(26-29-25-12-7-6-11-24(25)28(33)31(26)16-18-35-3)30(15-8-17-34-2)27(32)23-14-13-21-9-4-5-10-22(21)19-23/h4-7,9-14,19-20H,8,15-18H2,1-3H3 |
| InChIKey | HKCNFWPNNQKKGM-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.57 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|