C27H31N3O5S — CID 5135506
N-[1-[3-(2-methoxyethyl)-4-oxoquinazolin-2-yl]ethyl]-N-(3-methoxypropyl)naphthalene-2-sulfonamide (PubChem CID 5135506) has the molecular formula C27H31N3O5S and a molecular weight of 509.63 g/mol. Its IUPAC name is N-[1-[3-(2-methoxyethyl)-4-oxoquinazolin-2-yl]ethyl]-N-(3-methoxypropyl)naphthalene-2-sulfonamide.
| Compound Name | N-[1-[3-(2-methoxyethyl)-4-oxoquinazolin-2-yl]ethyl]-N-(3-methoxypropyl)naphthalene-2-sulfonamide |
|---|---|
| PubChem CID | 5135506 |
| Molecular Formula | C27H31N3O5S |
| Molecular Weight | 509.63 g/mol |
| Exact Mass | 509.20 |
| IUPAC Name | N-[1-[3-(2-methoxyethyl)-4-oxoquinazolin-2-yl]ethyl]-N-(3-methoxypropyl)naphthalene-2-sulfonamide |
| SMILES | COCCCN(C(C)c1nc2ccccc2c(=O)n1CCOC)S(=O)(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C27H31N3O5S/c1-20(26-28-25-12-7-6-11-24(25)27(31)29(26)16-18-35-3)30(15-8-17-34-2)36(32,33)23-14-13-21-9-4-5-10-22(21)19-23/h4-7,9-14,19-20H,8,15-18H2,1-3H3 |
| InChIKey | NZIGLPVREIQIAF-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 90.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.63 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|