C35H39N3O3S — CID 42720845
4-tert-butyl-N-[1-(3-naphthalen-2-yl-4-oxoquinazolin-2-yl)ethyl]-N-pentylbenzenesulfonamide (PubChem CID 42720845) has the molecular formula C35H39N3O3S and a molecular weight of 581.78 g/mol. Its IUPAC name is 4-tert-butyl-N-[1-(3-naphthalen-2-yl-4-oxoquinazolin-2-yl)ethyl]-N-pentylbenzenesulfonamide.
| Compound Name | 4-tert-butyl-N-[1-(3-naphthalen-2-yl-4-oxoquinazolin-2-yl)ethyl]-N-pentylbenzenesulfonamide |
|---|---|
| PubChem CID | 42720845 |
| Molecular Formula | C35H39N3O3S |
| Molecular Weight | 581.78 g/mol |
| Exact Mass | 581.27 |
| IUPAC Name | 4-tert-butyl-N-[1-(3-naphthalen-2-yl-4-oxoquinazolin-2-yl)ethyl]-N-pentylbenzenesulfonamide |
| SMILES | CCCCCN(C(C)c1nc2ccccc2c(=O)n1-c1ccc2ccccc2c1)S(=O)(=O)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C35H39N3O3S/c1-6-7-12-23-37(42(40,41)30-21-18-28(19-22-30)35(3,4)5)25(2)33-36-32-16-11-10-15-31(32)34(39)38(33)29-20-17-26-13-8-9-14-27(26)24-29/h8-11,13-22,24-25H,6-7,12,23H2,1-5H3 |
| InChIKey | RKYZTFPXXUFUIN-UHFFFAOYSA-N |
| XLogP | 7.78 |
| TPSA | 72.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.78 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|