C27H28FN3O3S — CID 3392926
N-[1-[3-(4-fluorophenyl)-4-oxoquinazolin-2-yl]ethyl]-N-(3-methylbutyl)benzenesulfonamide (PubChem CID 3392926) has the molecular formula C27H28FN3O3S and a molecular weight of 493.60 g/mol. Its IUPAC name is N-[1-[3-(4-fluorophenyl)-4-oxoquinazolin-2-yl]ethyl]-N-(3-methylbutyl)benzenesulfonamide.
| Compound Name | N-[1-[3-(4-fluorophenyl)-4-oxoquinazolin-2-yl]ethyl]-N-(3-methylbutyl)benzenesulfonamide |
|---|---|
| PubChem CID | 3392926 |
| Molecular Formula | C27H28FN3O3S |
| Molecular Weight | 493.60 g/mol |
| Exact Mass | 493.18 |
| IUPAC Name | N-[1-[3-(4-fluorophenyl)-4-oxoquinazolin-2-yl]ethyl]-N-(3-methylbutyl)benzenesulfonamide |
| SMILES | CC(C)CCN(C(C)c1nc2ccccc2c(=O)n1-c1ccc(F)cc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C27H28FN3O3S/c1-19(2)17-18-30(35(33,34)23-9-5-4-6-10-23)20(3)26-29-25-12-8-7-11-24(25)27(32)31(26)22-15-13-21(28)14-16-22/h4-16,19-20H,17-18H2,1-3H3 |
| InChIKey | QLCRJLFFXKTSGL-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 72.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.60 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |