C28H36FN3O2 — CID 42716087
N-butyl-2-ethyl-N-[1-[3-(4-fluorophenyl)-4-oxoquinazolin-2-yl]ethyl]hexanamide (PubChem CID 42716087) has the molecular formula C28H36FN3O2 and a molecular weight of 465.61 g/mol. Its IUPAC name is N-butyl-2-ethyl-N-[1-[3-(4-fluorophenyl)-4-oxoquinazolin-2-yl]ethyl]hexanamide.
| Compound Name | N-butyl-2-ethyl-N-[1-[3-(4-fluorophenyl)-4-oxoquinazolin-2-yl]ethyl]hexanamide |
|---|---|
| PubChem CID | 42716087 |
| Molecular Formula | C28H36FN3O2 |
| Molecular Weight | 465.61 g/mol |
| Exact Mass | 465.28 |
| IUPAC Name | N-butyl-2-ethyl-N-[1-[3-(4-fluorophenyl)-4-oxoquinazolin-2-yl]ethyl]hexanamide |
| SMILES | CCCCC(CC)C(=O)N(CCCC)C(C)c1nc2ccccc2c(=O)n1-c1ccc(F)cc1 |
| InChI | InChI=1S/C28H36FN3O2/c1-5-8-12-21(7-3)27(33)31(19-9-6-2)20(4)26-30-25-14-11-10-13-24(25)28(34)32(26)23-17-15-22(29)16-18-23/h10-11,13-18,20-21H,5-9,12,19H2,1-4H3 |
| InChIKey | VSFJJSKWWGBBSE-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.61 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |