C27H27F2N3O3S — CID 3572587
4-fluoro-N-[1-[3-(4-fluorophenyl)-4-oxoquinazolin-2-yl]ethyl]-N-pentylbenzenesulfonamide (PubChem CID 3572587) has the molecular formula C27H27F2N3O3S and a molecular weight of 511.59 g/mol. Its IUPAC name is 4-fluoro-N-[1-[3-(4-fluorophenyl)-4-oxoquinazolin-2-yl]ethyl]-N-pentylbenzenesulfonamide.
| Compound Name | 4-fluoro-N-[1-[3-(4-fluorophenyl)-4-oxoquinazolin-2-yl]ethyl]-N-pentylbenzenesulfonamide |
|---|---|
| PubChem CID | 3572587 |
| Molecular Formula | C27H27F2N3O3S |
| Molecular Weight | 511.59 g/mol |
| Exact Mass | 511.17 |
| IUPAC Name | 4-fluoro-N-[1-[3-(4-fluorophenyl)-4-oxoquinazolin-2-yl]ethyl]-N-pentylbenzenesulfonamide |
| SMILES | CCCCCN(C(C)c1nc2ccccc2c(=O)n1-c1ccc(F)cc1)S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C27H27F2N3O3S/c1-3-4-7-18-31(36(34,35)23-16-12-21(29)13-17-23)19(2)26-30-25-9-6-5-8-24(25)27(33)32(26)22-14-10-20(28)11-15-22/h5-6,8-17,19H,3-4,7,18H2,1-2H3 |
| InChIKey | ZHCPTPBCYYNJDL-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 72.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.59 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|