C31H31N3O3S — CID 42716998
N-[1-(4-oxo-3-phenylquinazolin-2-yl)ethyl]-N-pentylnaphthalene-1-sulfonamide (PubChem CID 42716998) has the molecular formula C31H31N3O3S and a molecular weight of 525.67 g/mol. Its IUPAC name is N-[1-(4-oxo-3-phenylquinazolin-2-yl)ethyl]-N-pentylnaphthalene-1-sulfonamide.
| Compound Name | N-[1-(4-oxo-3-phenylquinazolin-2-yl)ethyl]-N-pentylnaphthalene-1-sulfonamide |
|---|---|
| PubChem CID | 42716998 |
| Molecular Formula | C31H31N3O3S |
| Molecular Weight | 525.67 g/mol |
| Exact Mass | 525.21 |
| IUPAC Name | N-[1-(4-oxo-3-phenylquinazolin-2-yl)ethyl]-N-pentylnaphthalene-1-sulfonamide |
| SMILES | CCCCCN(C(C)c1nc2ccccc2c(=O)n1-c1ccccc1)S(=O)(=O)c1cccc2ccccc12 |
| InChI | InChI=1S/C31H31N3O3S/c1-3-4-12-22-33(38(36,37)29-21-13-15-24-14-8-9-18-26(24)29)23(2)30-32-28-20-11-10-19-27(28)31(35)34(30)25-16-6-5-7-17-25/h5-11,13-21,23H,3-4,12,22H2,1-2H3 |
| InChIKey | JVMOMEKRFGNXEY-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 72.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.67 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|