C27H29N3O3S — CID 42718462
N-butyl-N-[1-[3-(3-methylphenyl)-4-oxoquinazolin-2-yl]ethyl]benzenesulfonamide (PubChem CID 42718462) has the molecular formula C27H29N3O3S and a molecular weight of 475.61 g/mol. Its IUPAC name is N-butyl-N-[1-[3-(3-methylphenyl)-4-oxoquinazolin-2-yl]ethyl]benzenesulfonamide.
| Compound Name | N-butyl-N-[1-[3-(3-methylphenyl)-4-oxoquinazolin-2-yl]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 42718462 |
| Molecular Formula | C27H29N3O3S |
| Molecular Weight | 475.61 g/mol |
| Exact Mass | 475.19 |
| IUPAC Name | N-butyl-N-[1-[3-(3-methylphenyl)-4-oxoquinazolin-2-yl]ethyl]benzenesulfonamide |
| SMILES | CCCCN(C(C)c1nc2ccccc2c(=O)n1-c1cccc(C)c1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C27H29N3O3S/c1-4-5-18-29(34(32,33)23-14-7-6-8-15-23)21(3)26-28-25-17-10-9-16-24(25)27(31)30(26)22-13-11-12-20(2)19-22/h6-17,19,21H,4-5,18H2,1-3H3 |
| InChIKey | DEKWNBIYWUVELB-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 72.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.61 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |