C28H37N3O3 — CID 42717165
N-hexyl-N-[1-[3-(4-methoxyphenyl)-4-oxoquinazolin-2-yl]ethyl]-2,2-dimethylpropanamide (PubChem CID 42717165) has the molecular formula C28H37N3O3 and a molecular weight of 463.62 g/mol. Its IUPAC name is N-hexyl-N-[1-[3-(4-methoxyphenyl)-4-oxoquinazolin-2-yl]ethyl]-2,2-dimethylpropanamide.
| Compound Name | N-hexyl-N-[1-[3-(4-methoxyphenyl)-4-oxoquinazolin-2-yl]ethyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 42717165 |
| Molecular Formula | C28H37N3O3 |
| Molecular Weight | 463.62 g/mol |
| Exact Mass | 463.28 |
| IUPAC Name | N-hexyl-N-[1-[3-(4-methoxyphenyl)-4-oxoquinazolin-2-yl]ethyl]-2,2-dimethylpropanamide |
| SMILES | CCCCCCN(C(=O)C(C)(C)C)C(C)c1nc2ccccc2c(=O)n1-c1ccc(OC)cc1 |
| InChI | InChI=1S/C28H37N3O3/c1-7-8-9-12-19-30(27(33)28(3,4)5)20(2)25-29-24-14-11-10-13-23(24)26(32)31(25)21-15-17-22(34-6)18-16-21/h10-11,13-18,20H,7-9,12,19H2,1-6H3 |
| InChIKey | CKEJIWHLKJCJMO-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.62 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|