C27H29N3O4S — CID 42715475
4-methoxy-N-(2-methylpropyl)-N-[1-(4-oxo-3-phenylquinazolin-2-yl)ethyl]benzenesulfonamide (PubChem CID 42715475) has the molecular formula C27H29N3O4S and a molecular weight of 491.61 g/mol. Its IUPAC name is 4-methoxy-N-(2-methylpropyl)-N-[1-(4-oxo-3-phenylquinazolin-2-yl)ethyl]benzenesulfonamide.
| Compound Name | 4-methoxy-N-(2-methylpropyl)-N-[1-(4-oxo-3-phenylquinazolin-2-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 42715475 |
| Molecular Formula | C27H29N3O4S |
| Molecular Weight | 491.61 g/mol |
| Exact Mass | 491.19 |
| IUPAC Name | 4-methoxy-N-(2-methylpropyl)-N-[1-(4-oxo-3-phenylquinazolin-2-yl)ethyl]benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)N(CC(C)C)C(C)c2nc3ccccc3c(=O)n2-c2ccccc2)cc1 |
| InChI | InChI=1S/C27H29N3O4S/c1-19(2)18-29(35(32,33)23-16-14-22(34-4)15-17-23)20(3)26-28-25-13-9-8-12-24(25)27(31)30(26)21-10-6-5-7-11-21/h5-17,19-20H,18H2,1-4H3 |
| InChIKey | PCZOOSSKWCNEOR-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.61 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |