C29H25N3O3S — CID 66689029
N-methyl-N-[1-(4-oxo-3-phenylquinazolin-2-yl)ethyl]-4-phenylbenzenesulfonamide (PubChem CID 66689029) has the molecular formula C29H25N3O3S and a molecular weight of 495.60 g/mol. Its IUPAC name is N-methyl-N-[1-(4-oxo-3-phenylquinazolin-2-yl)ethyl]-4-phenylbenzenesulfonamide.
| Compound Name | N-methyl-N-[1-(4-oxo-3-phenylquinazolin-2-yl)ethyl]-4-phenylbenzenesulfonamide |
|---|---|
| PubChem CID | 66689029 |
| Molecular Formula | C29H25N3O3S |
| Molecular Weight | 495.60 g/mol |
| Exact Mass | 495.16 |
| IUPAC Name | N-methyl-N-[1-(4-oxo-3-phenylquinazolin-2-yl)ethyl]-4-phenylbenzenesulfonamide |
| SMILES | CC(c1nc2ccccc2c(=O)n1-c1ccccc1)N(C)S(=O)(=O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C29H25N3O3S/c1-21(31(2)36(34,35)25-19-17-23(18-20-25)22-11-5-3-6-12-22)28-30-27-16-10-9-15-26(27)29(33)32(28)24-13-7-4-8-14-24/h3-21H,1-2H3 |
| InChIKey | LJYOVQFDNKGBDH-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 72.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.60 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |