C26H24Cl2N4O6S — CID 3921568
4-chloro-N-[1-[3-(4-chlorophenyl)-4-oxoquinazolin-2-yl]ethyl]-N-(3-methoxypropyl)-3-nitrobenzenesulfonamide (PubChem CID 3921568) has the molecular formula C26H24Cl2N4O6S and a molecular weight of 591.47 g/mol. Its IUPAC name is 4-chloro-N-[1-[3-(4-chlorophenyl)-4-oxoquinazolin-2-yl]ethyl]-N-(3-methoxypropyl)-3-nitrobenzenesulfonamide.
| Compound Name | 4-chloro-N-[1-[3-(4-chlorophenyl)-4-oxoquinazolin-2-yl]ethyl]-N-(3-methoxypropyl)-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 3921568 |
| Molecular Formula | C26H24Cl2N4O6S |
| Molecular Weight | 591.47 g/mol |
| Exact Mass | 590.08 |
| IUPAC Name | 4-chloro-N-[1-[3-(4-chlorophenyl)-4-oxoquinazolin-2-yl]ethyl]-N-(3-methoxypropyl)-3-nitrobenzenesulfonamide |
| SMILES | COCCCN(C(C)c1nc2ccccc2c(=O)n1-c1ccc(Cl)cc1)S(=O)(=O)c1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C26H24Cl2N4O6S/c1-17(30(14-5-15-38-2)39(36,37)20-12-13-22(28)24(16-20)32(34)35)25-29-23-7-4-3-6-21(23)26(33)31(25)19-10-8-18(27)9-11-19/h3-4,6-13,16-17H,5,14-15H2,1-2H3 |
| InChIKey | YOBFNWNUTZZZNJ-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 124.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.47 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|