C29H29ClN4O5 — CID 3296835
2-chloro-N-(3-methoxypropyl)-N-[1-[3-(4-methylphenyl)-4-oxoquinazolin-2-yl]propyl]-4-nitrobenzamide (PubChem CID 3296835) has the molecular formula C29H29ClN4O5 and a molecular weight of 549.03 g/mol. Its IUPAC name is 2-chloro-N-(3-methoxypropyl)-N-[1-[3-(4-methylphenyl)-4-oxoquinazolin-2-yl]propyl]-4-nitrobenzamide.
| Compound Name | 2-chloro-N-(3-methoxypropyl)-N-[1-[3-(4-methylphenyl)-4-oxoquinazolin-2-yl]propyl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 3296835 |
| Molecular Formula | C29H29ClN4O5 |
| Molecular Weight | 549.03 g/mol |
| Exact Mass | 548.18 |
| IUPAC Name | 2-chloro-N-(3-methoxypropyl)-N-[1-[3-(4-methylphenyl)-4-oxoquinazolin-2-yl]propyl]-4-nitrobenzamide |
| SMILES | CCC(c1nc2ccccc2c(=O)n1-c1ccc(C)cc1)N(CCCOC)C(=O)c1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C29H29ClN4O5/c1-4-26(32(16-7-17-39-3)28(35)22-15-14-21(34(37)38)18-24(22)30)27-31-25-9-6-5-8-23(25)29(36)33(27)20-12-10-19(2)11-13-20/h5-6,8-15,18,26H,4,7,16-17H2,1-3H3 |
| InChIKey | AIRRCSIDAIPBDK-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 107.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.03 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|