C27H25ClN4O4 — CID 42712049
N-benzyl-2-chloro-N-[1-(3-ethyl-4-oxoquinazolin-2-yl)propyl]-4-nitrobenzamide (PubChem CID 42712049) has the molecular formula C27H25ClN4O4 and a molecular weight of 504.97 g/mol. Its IUPAC name is N-benzyl-2-chloro-N-[1-(3-ethyl-4-oxoquinazolin-2-yl)propyl]-4-nitrobenzamide.
| Compound Name | N-benzyl-2-chloro-N-[1-(3-ethyl-4-oxoquinazolin-2-yl)propyl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 42712049 |
| Molecular Formula | C27H25ClN4O4 |
| Molecular Weight | 504.97 g/mol |
| Exact Mass | 504.16 |
| IUPAC Name | N-benzyl-2-chloro-N-[1-(3-ethyl-4-oxoquinazolin-2-yl)propyl]-4-nitrobenzamide |
| SMILES | CCC(c1nc2ccccc2c(=O)n1CC)N(Cc1ccccc1)C(=O)c1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C27H25ClN4O4/c1-3-24(25-29-23-13-9-8-12-21(23)27(34)30(25)4-2)31(17-18-10-6-5-7-11-18)26(33)20-15-14-19(32(35)36)16-22(20)28/h5-16,24H,3-4,17H2,1-2H3 |
| InChIKey | NCYDPDNTWJITIJ-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 98.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.97 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|