C24H28Cl2N4O4 — CID 42728617
3-(2,3-dichlorophenyl)-1-[1-[3-(2-methoxyethyl)-4-oxoquinazolin-2-yl]ethyl]-1-(3-methoxypropyl)urea (PubChem CID 42728617) has the molecular formula C24H28Cl2N4O4 and a molecular weight of 507.42 g/mol. Its IUPAC name is 3-(2,3-dichlorophenyl)-1-[1-[3-(2-methoxyethyl)-4-oxoquinazolin-2-yl]ethyl]-1-(3-methoxypropyl)urea.
| Compound Name | 3-(2,3-dichlorophenyl)-1-[1-[3-(2-methoxyethyl)-4-oxoquinazolin-2-yl]ethyl]-1-(3-methoxypropyl)urea |
|---|---|
| PubChem CID | 42728617 |
| Molecular Formula | C24H28Cl2N4O4 |
| Molecular Weight | 507.42 g/mol |
| Exact Mass | 506.15 |
| IUPAC Name | 3-(2,3-dichlorophenyl)-1-[1-[3-(2-methoxyethyl)-4-oxoquinazolin-2-yl]ethyl]-1-(3-methoxypropyl)urea |
| SMILES | COCCCN(C(=O)Nc1cccc(Cl)c1Cl)C(C)c1nc2ccccc2c(=O)n1CCOC |
| InChI | InChI=1S/C24H28Cl2N4O4/c1-16(22-27-19-10-5-4-8-17(19)23(31)30(22)13-15-34-3)29(12-7-14-33-2)24(32)28-20-11-6-9-18(25)21(20)26/h4-6,8-11,16H,7,12-15H2,1-3H3,(H,28,32) |
| InChIKey | MSBIICMWUQXZQK-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 85.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.42 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|