C21H20F3N3O3 — CID 7237096
N-[(1R)-1-[3-(2-methoxyethyl)-4-oxoquinazolin-2-yl]ethyl]-3-(trifluoromethyl)benzamide (PubChem CID 7237096) has the molecular formula C21H20F3N3O3 and a molecular weight of 419.40 g/mol. Its IUPAC name is N-[(1R)-1-[3-(2-methoxyethyl)-4-oxoquinazolin-2-yl]ethyl]-3-(trifluoromethyl)benzamide.
| Compound Name | N-[(1R)-1-[3-(2-methoxyethyl)-4-oxoquinazolin-2-yl]ethyl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 7237096 |
| Molecular Formula | C21H20F3N3O3 |
| Molecular Weight | 419.40 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | N-[(1R)-1-[3-(2-methoxyethyl)-4-oxoquinazolin-2-yl]ethyl]-3-(trifluoromethyl)benzamide |
| SMILES | COCCn1c([C@@H](C)NC(=O)c2cccc(C(F)(F)F)c2)nc2ccccc2c1=O |
| InChI | InChI=1S/C21H20F3N3O3/c1-13(25-19(28)14-6-5-7-15(12-14)21(22,23)24)18-26-17-9-4-3-8-16(17)20(29)27(18)10-11-30-2/h3-9,12-13H,10-11H2,1-2H3,(H,25,28)/t13-/m1/s1 |
| InChIKey | CEGFDFSGXUBAND-CYBMUJFWSA-N |
| XLogP | 3.55 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.40 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |