C21H21F3N4O3 — CID 3971646
1-[1-[3-(2-methoxyethyl)-4-oxoquinazolin-2-yl]ethyl]-3-[2-(trifluoromethyl)phenyl]urea (PubChem CID 3971646) has the molecular formula C21H21F3N4O3 and a molecular weight of 434.42 g/mol. Its IUPAC name is 1-[1-[3-(2-methoxyethyl)-4-oxoquinazolin-2-yl]ethyl]-3-[2-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[1-[3-(2-methoxyethyl)-4-oxoquinazolin-2-yl]ethyl]-3-[2-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 3971646 |
| Molecular Formula | C21H21F3N4O3 |
| Molecular Weight | 434.42 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | 1-[1-[3-(2-methoxyethyl)-4-oxoquinazolin-2-yl]ethyl]-3-[2-(trifluoromethyl)phenyl]urea |
| SMILES | COCCn1c(C(C)NC(=O)Nc2ccccc2C(F)(F)F)nc2ccccc2c1=O |
| InChI | InChI=1S/C21H21F3N4O3/c1-13(25-20(30)27-17-10-6-4-8-15(17)21(22,23)24)18-26-16-9-5-3-7-14(16)19(29)28(18)11-12-31-2/h3-10,13H,11-12H2,1-2H3,(H2,25,27,30) |
| InChIKey | PKYKVFHQNRWTIA-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.42 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |