C26H32Cl2N4O3 — CID 42717800
3-(3,4-dichlorophenyl)-1-[1-[3-(2-methoxyethyl)-4-oxoquinazolin-2-yl]propyl]-1-pentylurea (PubChem CID 42717800) has the molecular formula C26H32Cl2N4O3 and a molecular weight of 519.47 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-1-[1-[3-(2-methoxyethyl)-4-oxoquinazolin-2-yl]propyl]-1-pentylurea.
| Compound Name | 3-(3,4-dichlorophenyl)-1-[1-[3-(2-methoxyethyl)-4-oxoquinazolin-2-yl]propyl]-1-pentylurea |
|---|---|
| PubChem CID | 42717800 |
| Molecular Formula | C26H32Cl2N4O3 |
| Molecular Weight | 519.47 g/mol |
| Exact Mass | 518.19 |
| IUPAC Name | 3-(3,4-dichlorophenyl)-1-[1-[3-(2-methoxyethyl)-4-oxoquinazolin-2-yl]propyl]-1-pentylurea |
| SMILES | CCCCCN(C(=O)Nc1ccc(Cl)c(Cl)c1)C(CC)c1nc2ccccc2c(=O)n1CCOC |
| InChI | InChI=1S/C26H32Cl2N4O3/c1-4-6-9-14-31(26(34)29-18-12-13-20(27)21(28)17-18)23(5-2)24-30-22-11-8-7-10-19(22)25(33)32(24)15-16-35-3/h7-8,10-13,17,23H,4-6,9,14-16H2,1-3H3,(H,29,34) |
| InChIKey | GUFBQGRLQJTXHQ-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.47 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|