C24H31N3O4 — CID 42717635
N-[1-[3-(2-methoxyethyl)-4-oxoquinazolin-2-yl]propyl]-N-pentylfuran-2-carboxamide (PubChem CID 42717635) has the molecular formula C24H31N3O4 and a molecular weight of 425.53 g/mol. Its IUPAC name is N-[1-[3-(2-methoxyethyl)-4-oxoquinazolin-2-yl]propyl]-N-pentylfuran-2-carboxamide.
| Compound Name | N-[1-[3-(2-methoxyethyl)-4-oxoquinazolin-2-yl]propyl]-N-pentylfuran-2-carboxamide |
|---|---|
| PubChem CID | 42717635 |
| Molecular Formula | C24H31N3O4 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.23 |
| IUPAC Name | N-[1-[3-(2-methoxyethyl)-4-oxoquinazolin-2-yl]propyl]-N-pentylfuran-2-carboxamide |
| SMILES | CCCCCN(C(=O)c1ccco1)C(CC)c1nc2ccccc2c(=O)n1CCOC |
| InChI | InChI=1S/C24H31N3O4/c1-4-6-9-14-26(24(29)21-13-10-16-31-21)20(5-2)22-25-19-12-8-7-11-18(19)23(28)27(22)15-17-30-3/h7-8,10-13,16,20H,4-6,9,14-15,17H2,1-3H3 |
| InChIKey | QTAXGNHEZKGKAN-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 77.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|