C29H39N3O3 — CID 5141627
4-butyl-N-(3-methoxypropyl)-N-[1-(4-oxo-3-propylquinazolin-2-yl)propyl]benzamide (PubChem CID 5141627) has the molecular formula C29H39N3O3 and a molecular weight of 477.65 g/mol. Its IUPAC name is 4-butyl-N-(3-methoxypropyl)-N-[1-(4-oxo-3-propylquinazolin-2-yl)propyl]benzamide.
| Compound Name | 4-butyl-N-(3-methoxypropyl)-N-[1-(4-oxo-3-propylquinazolin-2-yl)propyl]benzamide |
|---|---|
| PubChem CID | 5141627 |
| Molecular Formula | C29H39N3O3 |
| Molecular Weight | 477.65 g/mol |
| Exact Mass | 477.30 |
| IUPAC Name | 4-butyl-N-(3-methoxypropyl)-N-[1-(4-oxo-3-propylquinazolin-2-yl)propyl]benzamide |
| SMILES | CCCCc1ccc(C(=O)N(CCCOC)C(CC)c2nc3ccccc3c(=O)n2CCC)cc1 |
| InChI | InChI=1S/C29H39N3O3/c1-5-8-12-22-15-17-23(18-16-22)28(33)31(20-11-21-35-4)26(7-3)27-30-25-14-10-9-13-24(25)29(34)32(27)19-6-2/h9-10,13-18,26H,5-8,11-12,19-21H2,1-4H3 |
| InChIKey | ULPNLASHHXTYNU-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.65 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|