C20H23N3O3 — CID 42713243
N-ethyl-N-[1-(4-oxo-3-propylquinazolin-2-yl)ethyl]furan-2-carboxamide (PubChem CID 42713243) has the molecular formula C20H23N3O3 and a molecular weight of 353.42 g/mol. Its IUPAC name is N-ethyl-N-[1-(4-oxo-3-propylquinazolin-2-yl)ethyl]furan-2-carboxamide.
| Compound Name | N-ethyl-N-[1-(4-oxo-3-propylquinazolin-2-yl)ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 42713243 |
| Molecular Formula | C20H23N3O3 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | N-ethyl-N-[1-(4-oxo-3-propylquinazolin-2-yl)ethyl]furan-2-carboxamide |
| SMILES | CCCn1c(C(C)N(CC)C(=O)c2ccco2)nc2ccccc2c1=O |
| InChI | InChI=1S/C20H23N3O3/c1-4-12-23-18(21-16-10-7-6-9-15(16)19(23)24)14(3)22(5-2)20(25)17-11-8-13-26-17/h6-11,13-14H,4-5,12H2,1-3H3 |
| InChIKey | ODVASJYEHMDLCD-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 68.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |