C25H25N3O4 — CID 42721625
N-[1-[3-(4-ethoxyphenyl)-4-oxoquinazolin-2-yl]ethyl]-N-ethylfuran-2-carboxamide (PubChem CID 42721625) has the molecular formula C25H25N3O4 and a molecular weight of 431.49 g/mol. Its IUPAC name is N-[1-[3-(4-ethoxyphenyl)-4-oxoquinazolin-2-yl]ethyl]-N-ethylfuran-2-carboxamide.
| Compound Name | N-[1-[3-(4-ethoxyphenyl)-4-oxoquinazolin-2-yl]ethyl]-N-ethylfuran-2-carboxamide |
|---|---|
| PubChem CID | 42721625 |
| Molecular Formula | C25H25N3O4 |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.18 |
| IUPAC Name | N-[1-[3-(4-ethoxyphenyl)-4-oxoquinazolin-2-yl]ethyl]-N-ethylfuran-2-carboxamide |
| SMILES | CCOc1ccc(-n2c(C(C)N(CC)C(=O)c3ccco3)nc3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C25H25N3O4/c1-4-27(25(30)22-11-8-16-32-22)17(3)23-26-21-10-7-6-9-20(21)24(29)28(23)18-12-14-19(15-13-18)31-5-2/h6-17H,4-5H2,1-3H3 |
| InChIKey | KEINOVIRSYRFID-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 77.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |