C29H31N3O3 — CID 42721644
N-butyl-N-[1-[3-(4-ethoxyphenyl)-4-oxoquinazolin-2-yl]ethyl]benzamide (PubChem CID 42721644) has the molecular formula C29H31N3O3 and a molecular weight of 469.59 g/mol. Its IUPAC name is N-butyl-N-[1-[3-(4-ethoxyphenyl)-4-oxoquinazolin-2-yl]ethyl]benzamide.
| Compound Name | N-butyl-N-[1-[3-(4-ethoxyphenyl)-4-oxoquinazolin-2-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 42721644 |
| Molecular Formula | C29H31N3O3 |
| Molecular Weight | 469.59 g/mol |
| Exact Mass | 469.24 |
| IUPAC Name | N-butyl-N-[1-[3-(4-ethoxyphenyl)-4-oxoquinazolin-2-yl]ethyl]benzamide |
| SMILES | CCCCN(C(=O)c1ccccc1)C(C)c1nc2ccccc2c(=O)n1-c1ccc(OCC)cc1 |
| InChI | InChI=1S/C29H31N3O3/c1-4-6-20-31(28(33)22-12-8-7-9-13-22)21(3)27-30-26-15-11-10-14-25(26)29(34)32(27)23-16-18-24(19-17-23)35-5-2/h7-19,21H,4-6,20H2,1-3H3 |
| InChIKey | GEAMKASWXLQTBL-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.59 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |