C28H37N3O4 — CID 42721462
N-[1-[3-(4-ethoxyphenyl)-4-oxoquinazolin-2-yl]ethyl]-N-(2-methoxyethyl)heptanamide (PubChem CID 42721462) has the molecular formula C28H37N3O4 and a molecular weight of 479.62 g/mol. Its IUPAC name is N-[1-[3-(4-ethoxyphenyl)-4-oxoquinazolin-2-yl]ethyl]-N-(2-methoxyethyl)heptanamide.
| Compound Name | N-[1-[3-(4-ethoxyphenyl)-4-oxoquinazolin-2-yl]ethyl]-N-(2-methoxyethyl)heptanamide |
|---|---|
| PubChem CID | 42721462 |
| Molecular Formula | C28H37N3O4 |
| Molecular Weight | 479.62 g/mol |
| Exact Mass | 479.28 |
| IUPAC Name | N-[1-[3-(4-ethoxyphenyl)-4-oxoquinazolin-2-yl]ethyl]-N-(2-methoxyethyl)heptanamide |
| SMILES | CCCCCCC(=O)N(CCOC)C(C)c1nc2ccccc2c(=O)n1-c1ccc(OCC)cc1 |
| InChI | InChI=1S/C28H37N3O4/c1-5-7-8-9-14-26(32)30(19-20-34-4)21(3)27-29-25-13-11-10-12-24(25)28(33)31(27)22-15-17-23(18-16-22)35-6-2/h10-13,15-18,21H,5-9,14,19-20H2,1-4H3 |
| InChIKey | CKLULIGXOYJAFE-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.62 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|