C28H38N4O3 — CID 42716709
1-butyl-3-tert-butyl-1-[1-[3-(4-ethoxyphenyl)-4-oxoquinazolin-2-yl]propyl]urea (PubChem CID 42716709) has the molecular formula C28H38N4O3 and a molecular weight of 478.64 g/mol. Its IUPAC name is 1-butyl-3-tert-butyl-1-[1-[3-(4-ethoxyphenyl)-4-oxoquinazolin-2-yl]propyl]urea.
| Compound Name | 1-butyl-3-tert-butyl-1-[1-[3-(4-ethoxyphenyl)-4-oxoquinazolin-2-yl]propyl]urea |
|---|---|
| PubChem CID | 42716709 |
| Molecular Formula | C28H38N4O3 |
| Molecular Weight | 478.64 g/mol |
| Exact Mass | 478.29 |
| IUPAC Name | 1-butyl-3-tert-butyl-1-[1-[3-(4-ethoxyphenyl)-4-oxoquinazolin-2-yl]propyl]urea |
| SMILES | CCCCN(C(=O)NC(C)(C)C)C(CC)c1nc2ccccc2c(=O)n1-c1ccc(OCC)cc1 |
| InChI | InChI=1S/C28H38N4O3/c1-7-10-19-31(27(34)30-28(4,5)6)24(8-2)25-29-23-14-12-11-13-22(23)26(33)32(25)20-15-17-21(18-16-20)35-9-3/h11-18,24H,7-10,19H2,1-6H3,(H,30,34) |
| InChIKey | BRDVQQZRTOCCFQ-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.64 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |