C34H41N3O4 — CID 3962561
4-tert-butyl-N-[1-[3-(4-ethoxyphenyl)-4-oxoquinazolin-2-yl]propyl]-N-(3-methoxypropyl)benzamide (PubChem CID 3962561) has the molecular formula C34H41N3O4 and a molecular weight of 555.72 g/mol. Its IUPAC name is 4-tert-butyl-N-[1-[3-(4-ethoxyphenyl)-4-oxoquinazolin-2-yl]propyl]-N-(3-methoxypropyl)benzamide.
| Compound Name | 4-tert-butyl-N-[1-[3-(4-ethoxyphenyl)-4-oxoquinazolin-2-yl]propyl]-N-(3-methoxypropyl)benzamide |
|---|---|
| PubChem CID | 3962561 |
| Molecular Formula | C34H41N3O4 |
| Molecular Weight | 555.72 g/mol |
| Exact Mass | 555.31 |
| IUPAC Name | 4-tert-butyl-N-[1-[3-(4-ethoxyphenyl)-4-oxoquinazolin-2-yl]propyl]-N-(3-methoxypropyl)benzamide |
| SMILES | CCOc1ccc(-n2c(C(CC)N(CCCOC)C(=O)c3ccc(C(C)(C)C)cc3)nc3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C34H41N3O4/c1-7-30(36(22-11-23-40-6)32(38)24-14-16-25(17-15-24)34(3,4)5)31-35-29-13-10-9-12-28(29)33(39)37(31)26-18-20-27(21-19-26)41-8-2/h9-10,12-21,30H,7-8,11,22-23H2,1-6H3 |
| InChIKey | HAVHHHJWNNKFQS-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.72 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|