C36H45N3O2 — CID 42719772
4-tert-butyl-N-[1-[3-(3,4-dimethylphenyl)-4-oxoquinazolin-2-yl]propyl]-N-hexylbenzamide (PubChem CID 42719772) has the molecular formula C36H45N3O2 and a molecular weight of 551.78 g/mol. Its IUPAC name is 4-tert-butyl-N-[1-[3-(3,4-dimethylphenyl)-4-oxoquinazolin-2-yl]propyl]-N-hexylbenzamide.
| Compound Name | 4-tert-butyl-N-[1-[3-(3,4-dimethylphenyl)-4-oxoquinazolin-2-yl]propyl]-N-hexylbenzamide |
|---|---|
| PubChem CID | 42719772 |
| Molecular Formula | C36H45N3O2 |
| Molecular Weight | 551.78 g/mol |
| Exact Mass | 551.35 |
| IUPAC Name | 4-tert-butyl-N-[1-[3-(3,4-dimethylphenyl)-4-oxoquinazolin-2-yl]propyl]-N-hexylbenzamide |
| SMILES | CCCCCCN(C(=O)c1ccc(C(C)(C)C)cc1)C(CC)c1nc2ccccc2c(=O)n1-c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C36H45N3O2/c1-8-10-11-14-23-38(34(40)27-18-20-28(21-19-27)36(5,6)7)32(9-2)33-37-31-16-13-12-15-30(31)35(41)39(33)29-22-17-25(3)26(4)24-29/h12-13,15-22,24,32H,8-11,14,23H2,1-7H3 |
| InChIKey | TYFVIQPQBKKQRZ-UHFFFAOYSA-N |
| XLogP | 8.47 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.78 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|