C32H34F3N3O2 — CID 4561999
N-[1-[3-(3,4-dimethylphenyl)-4-oxoquinazolin-2-yl]propyl]-N-pentyl-3-(trifluoromethyl)benzamide (PubChem CID 4561999) has the molecular formula C32H34F3N3O2 and a molecular weight of 549.64 g/mol. Its IUPAC name is N-[1-[3-(3,4-dimethylphenyl)-4-oxoquinazolin-2-yl]propyl]-N-pentyl-3-(trifluoromethyl)benzamide.
| Compound Name | N-[1-[3-(3,4-dimethylphenyl)-4-oxoquinazolin-2-yl]propyl]-N-pentyl-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 4561999 |
| Molecular Formula | C32H34F3N3O2 |
| Molecular Weight | 549.64 g/mol |
| Exact Mass | 549.26 |
| IUPAC Name | N-[1-[3-(3,4-dimethylphenyl)-4-oxoquinazolin-2-yl]propyl]-N-pentyl-3-(trifluoromethyl)benzamide |
| SMILES | CCCCCN(C(=O)c1cccc(C(F)(F)F)c1)C(CC)c1nc2ccccc2c(=O)n1-c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C32H34F3N3O2/c1-5-7-10-18-37(30(39)23-12-11-13-24(20-23)32(33,34)35)28(6-2)29-36-27-15-9-8-14-26(27)31(40)38(29)25-17-16-21(3)22(4)19-25/h8-9,11-17,19-20,28H,5-7,10,18H2,1-4H3 |
| InChIKey | AEUMDYTYXHENER-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.64 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|