C29H39N3O4 — CID 42728547
N-[1-[3-(4-ethoxyphenyl)-4-oxoquinazolin-2-yl]propyl]-N-(3-methoxypropyl)-3,3-dimethylbutanamide (PubChem CID 42728547) has the molecular formula C29H39N3O4 and a molecular weight of 493.65 g/mol. Its IUPAC name is N-[1-[3-(4-ethoxyphenyl)-4-oxoquinazolin-2-yl]propyl]-N-(3-methoxypropyl)-3,3-dimethylbutanamide.
| Compound Name | N-[1-[3-(4-ethoxyphenyl)-4-oxoquinazolin-2-yl]propyl]-N-(3-methoxypropyl)-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 42728547 |
| Molecular Formula | C29H39N3O4 |
| Molecular Weight | 493.65 g/mol |
| Exact Mass | 493.29 |
| IUPAC Name | N-[1-[3-(4-ethoxyphenyl)-4-oxoquinazolin-2-yl]propyl]-N-(3-methoxypropyl)-3,3-dimethylbutanamide |
| SMILES | CCOc1ccc(-n2c(C(CC)N(CCCOC)C(=O)CC(C)(C)C)nc3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C29H39N3O4/c1-7-25(31(18-11-19-35-6)26(33)20-29(3,4)5)27-30-24-13-10-9-12-23(24)28(34)32(27)21-14-16-22(17-15-21)36-8-2/h9-10,12-17,25H,7-8,11,18-20H2,1-6H3 |
| InChIKey | ZAMWDKQRRNLZEQ-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.65 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|