C25H31FN4O2 — CID 42718843
3-tert-butyl-1-[1-[3-(4-fluorophenyl)-4-oxoquinazolin-2-yl]propyl]-1-propylurea (PubChem CID 42718843) has the molecular formula C25H31FN4O2 and a molecular weight of 438.55 g/mol. Its IUPAC name is 3-tert-butyl-1-[1-[3-(4-fluorophenyl)-4-oxoquinazolin-2-yl]propyl]-1-propylurea.
| Compound Name | 3-tert-butyl-1-[1-[3-(4-fluorophenyl)-4-oxoquinazolin-2-yl]propyl]-1-propylurea |
|---|---|
| PubChem CID | 42718843 |
| Molecular Formula | C25H31FN4O2 |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.24 |
| IUPAC Name | 3-tert-butyl-1-[1-[3-(4-fluorophenyl)-4-oxoquinazolin-2-yl]propyl]-1-propylurea |
| SMILES | CCCN(C(=O)NC(C)(C)C)C(CC)c1nc2ccccc2c(=O)n1-c1ccc(F)cc1 |
| InChI | InChI=1S/C25H31FN4O2/c1-6-16-29(24(32)28-25(3,4)5)21(7-2)22-27-20-11-9-8-10-19(20)23(31)30(22)18-14-12-17(26)13-15-18/h8-15,21H,6-7,16H2,1-5H3,(H,28,32) |
| InChIKey | ZCEZPZYIPBEPJZ-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |