C18H17BrN2O2 — CID 58601638
2-(1-bromoethyl)-3-(4-ethoxyphenyl)quinazolin-4-one (PubChem CID 58601638) has the molecular formula C18H17BrN2O2 and a molecular weight of 373.25 g/mol. Its IUPAC name is 2-(1-bromoethyl)-3-(4-ethoxyphenyl)quinazolin-4-one.
| Compound Name | 2-(1-bromoethyl)-3-(4-ethoxyphenyl)quinazolin-4-one |
|---|---|
| PubChem CID | 58601638 |
| Molecular Formula | C18H17BrN2O2 |
| Molecular Weight | 373.25 g/mol |
| Exact Mass | 372.05 |
| IUPAC Name | 2-(1-bromoethyl)-3-(4-ethoxyphenyl)quinazolin-4-one |
| SMILES | CCOc1ccc(-n2c(C(C)Br)nc3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C18H17BrN2O2/c1-3-23-14-10-8-13(9-11-14)21-17(12(2)19)20-16-7-5-4-6-15(16)18(21)22/h4-12H,3H2,1-2H3 |
| InChIKey | RKMKTXCXWJGGIG-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.25 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|