C24H32N3O2+ — CID 7201737
[(1R)-1-[3-(4-ethoxyphenyl)-4-oxoquinazolin-2-yl]propyl]-pentylazanium (PubChem CID 7201737) has the molecular formula C24H32N3O2+ and a molecular weight of 394.54 g/mol. Its IUPAC name is [(1R)-1-[3-(4-ethoxyphenyl)-4-oxoquinazolin-2-yl]propyl]-pentylazanium.
| Compound Name | [(1R)-1-[3-(4-ethoxyphenyl)-4-oxoquinazolin-2-yl]propyl]-pentylazanium |
|---|---|
| PubChem CID | 7201737 |
| Molecular Formula | C24H32N3O2+ |
| Molecular Weight | 394.54 g/mol |
| Exact Mass | 394.25 |
| IUPAC Name | [(1R)-1-[3-(4-ethoxyphenyl)-4-oxoquinazolin-2-yl]propyl]-pentylazanium |
| SMILES | CCCCC[NH2+][C@H](CC)c1nc2ccccc2c(=O)n1-c1ccc(OCC)cc1 |
| InChI | InChI=1S/C24H31N3O2/c1-4-7-10-17-25-21(5-2)23-26-22-12-9-8-11-20(22)24(28)27(23)18-13-15-19(16-14-18)29-6-3/h8-9,11-16,21,25H,4-7,10,17H2,1-3H3/p+1/t21-/m1/s1 |
| InChIKey | YMTUHMOSYQEQLN-OAQYLSRUSA-O |
| XLogP | 3.99 |
| TPSA | 60.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.54 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|