C16H24N3O+ — CID 7288561
butyl-[(1S)-1-(3-methyl-4-oxoquinazolin-2-yl)propyl]azanium (PubChem CID 7288561) has the molecular formula C16H24N3O+ and a molecular weight of 274.39 g/mol. Its IUPAC name is butyl-[(1S)-1-(3-methyl-4-oxoquinazolin-2-yl)propyl]azanium.
| Compound Name | butyl-[(1S)-1-(3-methyl-4-oxoquinazolin-2-yl)propyl]azanium |
|---|---|
| PubChem CID | 7288561 |
| Molecular Formula | C16H24N3O+ |
| Molecular Weight | 274.39 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | butyl-[(1S)-1-(3-methyl-4-oxoquinazolin-2-yl)propyl]azanium |
| SMILES | CCCC[NH2+][C@@H](CC)c1nc2ccccc2c(=O)n1C |
| InChI | InChI=1S/C16H23N3O/c1-4-6-11-17-13(5-2)15-18-14-10-8-7-9-12(14)16(20)19(15)3/h7-10,13,17H,4-6,11H2,1-3H3/p+1/t13-/m0/s1 |
| InChIKey | MEIADIZJTGBNNZ-ZDUSSCGKSA-O |
| XLogP | 1.75 |
| TPSA | 51.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.39 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|