C18H30N4O+2 — CID 7412735
dimethyl-[2-[[(1S)-1-(4-oxo-3-propylquinazolin-2-yl)propyl]azaniumyl]ethyl]azanium (PubChem CID 7412735) has the molecular formula C18H30N4O+2 and a molecular weight of 318.46 g/mol. Its IUPAC name is dimethyl-[2-[[(1S)-1-(4-oxo-3-propylquinazolin-2-yl)propyl]azaniumyl]ethyl]azanium.
| Compound Name | dimethyl-[2-[[(1S)-1-(4-oxo-3-propylquinazolin-2-yl)propyl]azaniumyl]ethyl]azanium |
|---|---|
| PubChem CID | 7412735 |
| Molecular Formula | C18H30N4O+2 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.24 |
| IUPAC Name | dimethyl-[2-[[(1S)-1-(4-oxo-3-propylquinazolin-2-yl)propyl]azaniumyl]ethyl]azanium |
| SMILES | CCCn1c([C@H](CC)[NH2+]CC[NH+](C)C)nc2ccccc2c1=O |
| InChI | InChI=1S/C18H28N4O/c1-5-12-22-17(15(6-2)19-11-13-21(3)4)20-16-10-8-7-9-14(16)18(22)23/h7-10,15,19H,5-6,11-13H2,1-4H3/p+2/t15-/m0/s1 |
| InChIKey | LXIQCTGRARJZQP-HNNXBMFYSA-P |
| XLogP | -0.03 |
| TPSA | 55.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |