C19H22N3O+ — CID 7395887
ethyl-[(1R)-1-(4-oxo-3-phenylquinazolin-2-yl)propyl]azanium (PubChem CID 7395887) has the molecular formula C19H22N3O+ and a molecular weight of 308.40 g/mol. Its IUPAC name is ethyl-[(1R)-1-(4-oxo-3-phenylquinazolin-2-yl)propyl]azanium.
| Compound Name | ethyl-[(1R)-1-(4-oxo-3-phenylquinazolin-2-yl)propyl]azanium |
|---|---|
| PubChem CID | 7395887 |
| Molecular Formula | C19H22N3O+ |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | ethyl-[(1R)-1-(4-oxo-3-phenylquinazolin-2-yl)propyl]azanium |
| SMILES | CC[NH2+][C@H](CC)c1nc2ccccc2c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C19H21N3O/c1-3-16(20-4-2)18-21-17-13-9-8-12-15(17)19(23)22(18)14-10-6-5-7-11-14/h5-13,16,20H,3-4H2,1-2H3/p+1/t16-/m1/s1 |
| InChIKey | OKVBBTSALKINFW-MRXNPFEDSA-O |
| XLogP | 2.42 |
| TPSA | 51.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |