C21H24ClN3O — CID 1052024
3-(4-chlorophenyl)-2-[(1R)-1-(3-methylbutylamino)ethyl]quinazolin-4-one (PubChem CID 1052024) has the molecular formula C21H24ClN3O and a molecular weight of 369.90 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-2-[(1R)-1-(3-methylbutylamino)ethyl]quinazolin-4-one.
| Compound Name | 3-(4-chlorophenyl)-2-[(1R)-1-(3-methylbutylamino)ethyl]quinazolin-4-one |
|---|---|
| PubChem CID | 1052024 |
| Molecular Formula | C21H24ClN3O |
| Molecular Weight | 369.90 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | 3-(4-chlorophenyl)-2-[(1R)-1-(3-methylbutylamino)ethyl]quinazolin-4-one |
| SMILES | CC(C)CCN[C@H](C)c1nc2ccccc2c(=O)n1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H24ClN3O/c1-14(2)12-13-23-15(3)20-24-19-7-5-4-6-18(19)21(26)25(20)17-10-8-16(22)9-11-17/h4-11,14-15,23H,12-13H2,1-3H3/t15-/m1/s1 |
| InChIKey | MHJAZWZDJINJPC-OAHLLOKOSA-N |
| XLogP | 4.74 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.90 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |