C21H25ClN3O2+ — CID 7202025
[(1R)-1-[3-(4-chloro-2-methylphenyl)-4-oxoquinazolin-2-yl]propyl]-(2-methoxyethyl)azanium (PubChem CID 7202025) has the molecular formula C21H25ClN3O2+ and a molecular weight of 386.90 g/mol. Its IUPAC name is [(1R)-1-[3-(4-chloro-2-methylphenyl)-4-oxoquinazolin-2-yl]propyl]-(2-methoxyethyl)azanium.
| Compound Name | [(1R)-1-[3-(4-chloro-2-methylphenyl)-4-oxoquinazolin-2-yl]propyl]-(2-methoxyethyl)azanium |
|---|---|
| PubChem CID | 7202025 |
| Molecular Formula | C21H25ClN3O2+ |
| Molecular Weight | 386.90 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | [(1R)-1-[3-(4-chloro-2-methylphenyl)-4-oxoquinazolin-2-yl]propyl]-(2-methoxyethyl)azanium |
| SMILES | CC[C@@H]([NH2+]CCOC)c1nc2ccccc2c(=O)n1-c1ccc(Cl)cc1C |
| InChI | InChI=1S/C21H24ClN3O2/c1-4-17(23-11-12-27-3)20-24-18-8-6-5-7-16(18)21(26)25(20)19-10-9-15(22)13-14(19)2/h5-10,13,17,23H,4,11-12H2,1-3H3/p+1/t17-/m1/s1 |
| InChIKey | PCJPSCTXGOHLJQ-QGZVFWFLSA-O |
| XLogP | 3.01 |
| TPSA | 60.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.90 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|