C15H24N4O+2 — CID 7440089
dimethyl-[2-[[(1R)-1-(3-methyl-4-oxoquinazolin-2-yl)ethyl]azaniumyl]ethyl]azanium (PubChem CID 7440089) has the molecular formula C15H24N4O+2 and a molecular weight of 276.38 g/mol. Its IUPAC name is dimethyl-[2-[[(1R)-1-(3-methyl-4-oxoquinazolin-2-yl)ethyl]azaniumyl]ethyl]azanium.
| Compound Name | dimethyl-[2-[[(1R)-1-(3-methyl-4-oxoquinazolin-2-yl)ethyl]azaniumyl]ethyl]azanium |
|---|---|
| PubChem CID | 7440089 |
| Molecular Formula | C15H24N4O+2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.19 |
| IUPAC Name | dimethyl-[2-[[(1R)-1-(3-methyl-4-oxoquinazolin-2-yl)ethyl]azaniumyl]ethyl]azanium |
| SMILES | C[C@@H]([NH2+]CC[NH+](C)C)c1nc2ccccc2c(=O)n1C |
| InChI | InChI=1S/C15H22N4O/c1-11(16-9-10-18(2)3)14-17-13-8-6-5-7-12(13)15(20)19(14)4/h5-8,11,16H,9-10H2,1-4H3/p+2/t11-/m1/s1 |
| InChIKey | DOCPCFHZPBWLLE-LLVKDONJSA-P |
| XLogP | -1.30 |
| TPSA | 55.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |