C20H23ClN3O+ — CID 6961786
[(1R)-1-[3-(2-chlorophenyl)-4-oxoquinazolin-2-yl]ethyl]-(2-methylpropyl)azanium (PubChem CID 6961786) has the molecular formula C20H23ClN3O+ and a molecular weight of 356.88 g/mol. Its IUPAC name is [(1R)-1-[3-(2-chlorophenyl)-4-oxoquinazolin-2-yl]ethyl]-(2-methylpropyl)azanium.
| Compound Name | [(1R)-1-[3-(2-chlorophenyl)-4-oxoquinazolin-2-yl]ethyl]-(2-methylpropyl)azanium |
|---|---|
| PubChem CID | 6961786 |
| Molecular Formula | C20H23ClN3O+ |
| Molecular Weight | 356.88 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | [(1R)-1-[3-(2-chlorophenyl)-4-oxoquinazolin-2-yl]ethyl]-(2-methylpropyl)azanium |
| SMILES | CC(C)C[NH2+][C@H](C)c1nc2ccccc2c(=O)n1-c1ccccc1Cl |
| InChI | InChI=1S/C20H22ClN3O/c1-13(2)12-22-14(3)19-23-17-10-6-4-8-15(17)20(25)24(19)18-11-7-5-9-16(18)21/h4-11,13-14,22H,12H2,1-3H3/p+1/t14-/m1/s1 |
| InChIKey | UDVWGSYJSRMGLG-CQSZACIVSA-O |
| XLogP | 3.32 |
| TPSA | 51.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.88 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |