C25H26N3O+ — CID 7326981
benzyl-[(1R)-1-[3-(2,4-dimethylphenyl)-4-oxoquinazolin-2-yl]ethyl]azanium (PubChem CID 7326981) has the molecular formula C25H26N3O+ and a molecular weight of 384.50 g/mol. Its IUPAC name is benzyl-[(1R)-1-[3-(2,4-dimethylphenyl)-4-oxoquinazolin-2-yl]ethyl]azanium.
| Compound Name | benzyl-[(1R)-1-[3-(2,4-dimethylphenyl)-4-oxoquinazolin-2-yl]ethyl]azanium |
|---|---|
| PubChem CID | 7326981 |
| Molecular Formula | C25H26N3O+ |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.21 |
| IUPAC Name | benzyl-[(1R)-1-[3-(2,4-dimethylphenyl)-4-oxoquinazolin-2-yl]ethyl]azanium |
| SMILES | Cc1ccc(-n2c([C@@H](C)[NH2+]Cc3ccccc3)nc3ccccc3c2=O)c(C)c1 |
| InChI | InChI=1S/C25H25N3O/c1-17-13-14-23(18(2)15-17)28-24(19(3)26-16-20-9-5-4-6-10-20)27-22-12-8-7-11-21(22)25(28)29/h4-15,19,26H,16H2,1-3H3/p+1/t19-/m1/s1 |
| InChIKey | ABMUTHSQQOOKKD-LJQANCHMSA-O |
| XLogP | 3.83 |
| TPSA | 51.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |