C25H25N3O — CID 3997986
2-[1-(benzylamino)ethyl]-3-(2,5-dimethylphenyl)quinazolin-4-one (PubChem CID 3997986) has the molecular formula C25H25N3O and a molecular weight of 383.50 g/mol. Its IUPAC name is 2-[1-(benzylamino)ethyl]-3-(2,5-dimethylphenyl)quinazolin-4-one.
| Compound Name | 2-[1-(benzylamino)ethyl]-3-(2,5-dimethylphenyl)quinazolin-4-one |
|---|---|
| PubChem CID | 3997986 |
| Molecular Formula | C25H25N3O |
| Molecular Weight | 383.50 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | 2-[1-(benzylamino)ethyl]-3-(2,5-dimethylphenyl)quinazolin-4-one |
| SMILES | Cc1ccc(C)c(-n2c(C(C)NCc3ccccc3)nc3ccccc3c2=O)c1 |
| InChI | InChI=1S/C25H25N3O/c1-17-13-14-18(2)23(15-17)28-24(19(3)26-16-20-9-5-4-6-10-20)27-22-12-8-7-11-21(22)25(28)29/h4-15,19,26H,16H2,1-3H3 |
| InChIKey | RERVXAZFNOVNAE-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.50 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |