C21H25N3O — CID 3634718
2-[1-(butylamino)ethyl]-3-(2-methylphenyl)quinazolin-4-one (PubChem CID 3634718) has the molecular formula C21H25N3O and a molecular weight of 335.45 g/mol. Its IUPAC name is 2-[1-(butylamino)ethyl]-3-(2-methylphenyl)quinazolin-4-one.
| Compound Name | 2-[1-(butylamino)ethyl]-3-(2-methylphenyl)quinazolin-4-one |
|---|---|
| PubChem CID | 3634718 |
| Molecular Formula | C21H25N3O |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.20 |
| IUPAC Name | 2-[1-(butylamino)ethyl]-3-(2-methylphenyl)quinazolin-4-one |
| SMILES | CCCCNC(C)c1nc2ccccc2c(=O)n1-c1ccccc1C |
| InChI | InChI=1S/C21H25N3O/c1-4-5-14-22-16(3)20-23-18-12-8-7-11-17(18)21(25)24(20)19-13-9-6-10-15(19)2/h6-13,16,22H,4-5,14H2,1-3H3 |
| InChIKey | GKJZFZCOJKOZHR-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|