C14H20N3O+ — CID 6941068
methyl-[(1S)-1-(4-oxo-3-propylquinazolin-2-yl)ethyl]azanium (PubChem CID 6941068) has the molecular formula C14H20N3O+ and a molecular weight of 246.33 g/mol. Its IUPAC name is methyl-[(1S)-1-(4-oxo-3-propylquinazolin-2-yl)ethyl]azanium.
| Compound Name | methyl-[(1S)-1-(4-oxo-3-propylquinazolin-2-yl)ethyl]azanium |
|---|---|
| PubChem CID | 6941068 |
| Molecular Formula | C14H20N3O+ |
| Molecular Weight | 246.33 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | methyl-[(1S)-1-(4-oxo-3-propylquinazolin-2-yl)ethyl]azanium |
| SMILES | CCCn1c([C@H](C)[NH2+]C)nc2ccccc2c1=O |
| InChI | InChI=1S/C14H19N3O/c1-4-9-17-13(10(2)15-3)16-12-8-6-5-7-11(12)14(17)18/h5-8,10,15H,4,9H2,1-3H3/p+1/t10-/m0/s1 |
| InChIKey | SQYWFBMXBHOKQV-JTQLQIEISA-O |
| XLogP | 1.06 |
| TPSA | 51.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.33 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |