C27H30N4O4 — CID 42713639
3-benzyl-1-(furan-2-ylmethyl)-1-[1-[3-(2-methoxyethyl)-4-oxoquinazolin-2-yl]propyl]urea (PubChem CID 42713639) has the molecular formula C27H30N4O4 and a molecular weight of 474.56 g/mol. Its IUPAC name is 3-benzyl-1-(furan-2-ylmethyl)-1-[1-[3-(2-methoxyethyl)-4-oxoquinazolin-2-yl]propyl]urea.
| Compound Name | 3-benzyl-1-(furan-2-ylmethyl)-1-[1-[3-(2-methoxyethyl)-4-oxoquinazolin-2-yl]propyl]urea |
|---|---|
| PubChem CID | 42713639 |
| Molecular Formula | C27H30N4O4 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.23 |
| IUPAC Name | 3-benzyl-1-(furan-2-ylmethyl)-1-[1-[3-(2-methoxyethyl)-4-oxoquinazolin-2-yl]propyl]urea |
| SMILES | CCC(c1nc2ccccc2c(=O)n1CCOC)N(Cc1ccco1)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C27H30N4O4/c1-3-24(25-29-23-14-8-7-13-22(23)26(32)30(25)15-17-34-2)31(19-21-12-9-16-35-21)27(33)28-18-20-10-5-4-6-11-20/h4-14,16,24H,3,15,17-19H2,1-2H3,(H,28,33) |
| InChIKey | BEYCTLLFYFMFRD-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 89.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |