C19H19Cl2N3O3 — CID 42711860
2,2-dichloro-N-(furan-2-ylmethyl)-N-[1-(3-methyl-4-oxoquinazolin-2-yl)propyl]acetamide (PubChem CID 42711860) has the molecular formula C19H19Cl2N3O3 and a molecular weight of 408.29 g/mol. Its IUPAC name is 2,2-dichloro-N-(furan-2-ylmethyl)-N-[1-(3-methyl-4-oxoquinazolin-2-yl)propyl]acetamide.
| Compound Name | 2,2-dichloro-N-(furan-2-ylmethyl)-N-[1-(3-methyl-4-oxoquinazolin-2-yl)propyl]acetamide |
|---|---|
| PubChem CID | 42711860 |
| Molecular Formula | C19H19Cl2N3O3 |
| Molecular Weight | 408.29 g/mol |
| Exact Mass | 407.08 |
| IUPAC Name | 2,2-dichloro-N-(furan-2-ylmethyl)-N-[1-(3-methyl-4-oxoquinazolin-2-yl)propyl]acetamide |
| SMILES | CCC(c1nc2ccccc2c(=O)n1C)N(Cc1ccco1)C(=O)C(Cl)Cl |
| InChI | InChI=1S/C19H19Cl2N3O3/c1-3-15(24(19(26)16(20)21)11-12-7-6-10-27-12)17-22-14-9-5-4-8-13(14)18(25)23(17)2/h4-10,15-16H,3,11H2,1-2H3 |
| InChIKey | OAJBHHBTJPKEER-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 68.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.29 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|