C19H28N4O2 — CID 42711191
3-tert-butyl-1-ethyl-1-[1-(3-methyl-4-oxoquinazolin-2-yl)propyl]urea (PubChem CID 42711191) has the molecular formula C19H28N4O2 and a molecular weight of 344.46 g/mol. Its IUPAC name is 3-tert-butyl-1-ethyl-1-[1-(3-methyl-4-oxoquinazolin-2-yl)propyl]urea.
| Compound Name | 3-tert-butyl-1-ethyl-1-[1-(3-methyl-4-oxoquinazolin-2-yl)propyl]urea |
|---|---|
| PubChem CID | 42711191 |
| Molecular Formula | C19H28N4O2 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.22 |
| IUPAC Name | 3-tert-butyl-1-ethyl-1-[1-(3-methyl-4-oxoquinazolin-2-yl)propyl]urea |
| SMILES | CCC(c1nc2ccccc2c(=O)n1C)N(CC)C(=O)NC(C)(C)C |
| InChI | InChI=1S/C19H28N4O2/c1-7-15(23(8-2)18(25)21-19(3,4)5)16-20-14-12-10-9-11-13(14)17(24)22(16)6/h9-12,15H,7-8H2,1-6H3,(H,21,25) |
| InChIKey | WFPWUULUOXRWAA-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |